About 2-(1H-indol-2-yl)phenol
2-(1H-indol-2-yl)phenol (PubChem CID 700009) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(1H-indol-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(1H-indol-2-yl)phenol |
| PubChem CID | 700009 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-(1H-indol-2-yl)phenol |
| SMILES | Oc1ccccc1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H11NO/c16-14-8-4-2-6-11(14)13-9-10-5-1-3-7-12(10)15-13/h1-9,15-16H |
| InChIKey | WKZRPPBUMLPCRF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1H-indol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-2-yl)phenol?
The IUPAC name of 2-(1H-indol-2-yl)phenol (CID 700009) is 2-(1H-indol-2-yl)phenol.
What is the SMILES notation for 2-(1H-indol-2-yl)phenol?
The canonical SMILES for 2-(1H-indol-2-yl)phenol is Oc1ccccc1-c1cc2ccccc2[nH]1.
What is the InChIKey of 2-(1H-indol-2-yl)phenol?
The InChIKey is WKZRPPBUMLPCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c16-14-8-4-2-6-11(14)13-9-10-5-1-3-7-12(10)15-13/h1-9,15-16H.
What are the key properties of 2-(1H-indol-2-yl)phenol?
2-(1H-indol-2-yl)phenol has a molecular weight of 209.25 g/mol, XLogP of 3.54, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-2-yl)phenol is sourced from PubChem (CID 700009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).