C9H17ClN2 — CID 70001096
1-butyl-1,2-dimethylimidazol-1-ium chloride (PubChem CID 70001096) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is 1-butyl-1,2-dimethylimidazol-1-ium chloride.
| Compound Name | 1-butyl-1,2-dimethylimidazol-1-ium chloride |
|---|---|
| PubChem CID | 70001096 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-butyl-1,2-dimethylimidazol-1-ium chloride |
| SMILES | CCCC[N+]1(C)C=CN=C1C.[Cl-] |
| InChI | InChI=1S/C9H17N2.ClH/c1-4-5-7-11(3)8-6-10-9(11)2;/h6,8H,4-5,7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PDWZURPQBJQFBO-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|