About 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine
2-pentyl-3-pyridin-2-yl-1,2-oxazolidine (PubChem CID 70001193) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine |
| PubChem CID | 70001193 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine |
| SMILES | CCCCCN1OCCC1c1ccccn1 |
| InChI | InChI=1S/C13H20N2O/c1-2-3-6-10-15-13(8-11-16-15)12-7-4-5-9-14-12/h4-5,7,9,13H,2-3,6,8,10-11H2,1H3 |
| InChIKey | IJBOGSAMAAIXRJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine?
The IUPAC name of 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine (CID 70001193) is 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine.
What is the SMILES notation for 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine?
The canonical SMILES for 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine is CCCCCN1OCCC1c1ccccn1.
What is the InChIKey of 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine?
The InChIKey is IJBOGSAMAAIXRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-2-3-6-10-15-13(8-11-16-15)12-7-4-5-9-14-12/h4-5,7,9,13H,2-3,6,8,10-11H2,1H3.
What are the key properties of 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine?
2-pentyl-3-pyridin-2-yl-1,2-oxazolidine has a molecular weight of 220.32 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-3-pyridin-2-yl-1,2-oxazolidine is sourced from PubChem (CID 70001193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).