C19H19F3N4O2 — CID 70001283
(1R)-1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)pyrazol-3-yl]phenoxy]ethylamino]ethanol (PubChem CID 70001283) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is (1R)-1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)pyrazol-3-yl]phenoxy]ethylamino]ethanol.
| Compound Name | (1R)-1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)pyrazol-3-yl]phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 70001283 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (1R)-1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)pyrazol-3-yl]phenoxy]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2ccnn2C(F)(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)26-17(7-9-25-26)14-3-5-16(6-4-14)28-11-10-24-13-18(27)15-2-1-8-23-12-15/h1-9,12,18,24,27H,10-11,13H2/t18-/m0/s1 |
| InChIKey | KJZVIMIPPDZESA-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|