About (1S)-1-cyclohexyl-1,2-dihydrophthalazine
(1S)-1-cyclohexyl-1,2-dihydrophthalazine (PubChem CID 70001428) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-1,2-dihydrophthalazine.
Molecular Properties
| Compound Name | (1S)-1-cyclohexyl-1,2-dihydrophthalazine |
| PubChem CID | 70001428 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (1S)-1-cyclohexyl-1,2-dihydrophthalazine |
| SMILES | C1=NN[C@@H](C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H18N2/c1-2-6-11(7-3-1)14-13-9-5-4-8-12(13)10-15-16-14/h4-5,8-11,14,16H,1-3,6-7H2/t14-/m0/s1 |
| InChIKey | CJRAMJPBRMGDSI-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-cyclohexyl-1,2-dihydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclohexyl-1,2-dihydrophthalazine?
The IUPAC name of (1S)-1-cyclohexyl-1,2-dihydrophthalazine (CID 70001428) is (1S)-1-cyclohexyl-1,2-dihydrophthalazine.
What is the SMILES notation for (1S)-1-cyclohexyl-1,2-dihydrophthalazine?
The canonical SMILES for (1S)-1-cyclohexyl-1,2-dihydrophthalazine is C1=NN[C@@H](C2CCCCC2)c2ccccc21.
What is the InChIKey of (1S)-1-cyclohexyl-1,2-dihydrophthalazine?
The InChIKey is CJRAMJPBRMGDSI-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H18N2/c1-2-6-11(7-3-1)14-13-9-5-4-8-12(13)10-15-16-14/h4-5,8-11,14,16H,1-3,6-7H2/t14-/m0/s1.
What are the key properties of (1S)-1-cyclohexyl-1,2-dihydrophthalazine?
(1S)-1-cyclohexyl-1,2-dihydrophthalazine has a molecular weight of 214.31 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclohexyl-1,2-dihydrophthalazine is sourced from PubChem (CID 70001428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).