C27H24Cl2F3N3O4 — CID 70002719
[4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 3-(chloromethyl)benzoate;N,N-dimethylmethanamine (PubChem CID 70002719) has the molecular formula C27H24Cl2F3N3O4 and a molecular weight of 582.41 g/mol. Its IUPAC name is [4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 3-(chloromethyl)benzoate;N,N-dimethylmethanamine.
| Compound Name | [4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 3-(chloromethyl)benzoate;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 70002719 |
| Molecular Formula | C27H24Cl2F3N3O4 |
| Molecular Weight | 582.41 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | [4-chloro-2-[[2-oxo-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-3-yl]methyl]phenyl] 3-(chloromethyl)benzoate;N,N-dimethylmethanamine |
| SMILES | CN(C)C.O=C(Oc1ccc(Cl)cc1Cn1nc(-c2ccc(C(F)(F)F)cc2)oc1=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C24H15Cl2F3N2O4.C3H9N/c25-12-14-2-1-3-16(10-14)22(32)34-20-9-8-19(26)11-17(20)13-31-23(33)35-21(30-31)15-4-6-18(7-5-15)24(27,28)29;1-4(2)3/h1-11H,12-13H2;1-3H3 |
| InChIKey | SPCLTMBHKPUAJE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.41 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|