About 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine
4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 70002730) has the molecular formula C19H18FN3O
and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 70002730 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | CCN1CCOc2ccc(-c3cnc(-c4ccc(F)cc4)[nH]3)cc21 |
| InChI | InChI=1S/C19H18FN3O/c1-2-23-9-10-24-18-8-5-14(11-17(18)23)16-12-21-19(22-16)13-3-6-15(20)7-4-13/h3-8,11-12H,2,9-10H2,1H3,(H,21,22) |
| InChIKey | BTUBZONCUUUVIO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine (CID 70002730) is 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine is CCN1CCOc2ccc(-c3cnc(-c4ccc(F)cc4)[nH]3)cc21.
What is the InChIKey of 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine?
The InChIKey is BTUBZONCUUUVIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3O/c1-2-23-9-10-24-18-8-5-14(11-17(18)23)16-12-21-19(22-16)13-3-6-15(20)7-4-13/h3-8,11-12H,2,9-10H2,1H3,(H,21,22).
What are the key properties of 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine?
4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine has a molecular weight of 323.37 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 70002730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).