C11H16N2 — CID 70003260
1-ethyl-2,3,4,8-tetrahydro-1,2-benzodiazepine (PubChem CID 70003260) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-ethyl-2,3,4,8-tetrahydro-1,2-benzodiazepine.
| Compound Name | 1-ethyl-2,3,4,8-tetrahydro-1,2-benzodiazepine |
|---|---|
| PubChem CID | 70003260 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-ethyl-2,3,4,8-tetrahydro-1,2-benzodiazepine |
| SMILES | CCN1NCCC=C2C=CCC=C21 |
| InChI | InChI=1S/C11H16N2/c1-2-13-11-8-4-3-6-10(11)7-5-9-12-13/h3,6-8,12H,2,4-5,9H2,1H3 |
| InChIKey | PHEYBRATYGIHJO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |