About 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine
2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine (PubChem CID 70003359) has the molecular formula C10H8N4O
and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
Molecular Properties
| Compound Name | 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| PubChem CID | 70003359 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| SMILES | Nc1cccc2nc(-c3ccoc3)nn12 |
| InChI | InChI=1S/C10H8N4O/c11-8-2-1-3-9-12-10(13-14(8)9)7-4-5-15-6-7/h1-6H,11H2 |
| InChIKey | ALMAPQHRWZEQHC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine?
The IUPAC name of 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine (CID 70003359) is 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
What is the SMILES notation for 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine?
The canonical SMILES for 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine is Nc1cccc2nc(-c3ccoc3)nn12.
What is the InChIKey of 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine?
The InChIKey is ALMAPQHRWZEQHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O/c11-8-2-1-3-9-12-10(13-14(8)9)7-4-5-15-6-7/h1-6H,11H2.
What are the key properties of 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine?
2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine has a molecular weight of 200.20 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-5-amine is sourced from PubChem (CID 70003359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).