About [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate
[(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate (PubChem CID 70003431) has the molecular formula C17H26NO3S+
and a molecular weight of 324.47 g/mol. Its IUPAC name is [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate.
Molecular Properties
| Compound Name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate |
| PubChem CID | 70003431 |
| Molecular Formula | C17H26NO3S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate |
| SMILES | C[N+]1(C)CC[C@H](OC(=O)Cc2scc(C3CCCC3)c2O)C1 |
| InChI | InChI=1S/C17H25NO3S/c1-18(2)8-7-13(10-18)21-16(19)9-15-17(20)14(11-22-15)12-5-3-4-6-12/h11-13H,3-10H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | XAAIDECIAQHJAX-ZDUSSCGKSA-O |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate?
The IUPAC name of [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate (CID 70003431) is [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate.
What is the SMILES notation for [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate?
The canonical SMILES for [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate is C[N+]1(C)CC[C@H](OC(=O)Cc2scc(C3CCCC3)c2O)C1.
What is the InChIKey of [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate?
The InChIKey is XAAIDECIAQHJAX-ZDUSSCGKSA-O. The full InChI is InChI=1S/C17H25NO3S/c1-18(2)8-7-13(10-18)21-16(19)9-15-17(20)14(11-22-15)12-5-3-4-6-12/h11-13H,3-10H2,1-2H3/p+1/t13-/m0/s1.
What are the key properties of [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate?
[(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate has a molecular weight of 324.47 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(4-cyclopentyl-3-hydroxythiophen-2-yl)acetate is sourced from PubChem (CID 70003431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).