C25H27F2N3O — CID 70003489
(3R)-3-[2-[2-benzyl-6-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol (PubChem CID 70003489) has the molecular formula C25H27F2N3O and a molecular weight of 423.51 g/mol. Its IUPAC name is (3R)-3-[2-[2-benzyl-6-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol.
| Compound Name | (3R)-3-[2-[2-benzyl-6-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol |
|---|---|
| PubChem CID | 70003489 |
| Molecular Formula | C25H27F2N3O |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (3R)-3-[2-[2-benzyl-6-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol |
| SMILES | O[C@]1(C#Cc2ccc(N3C[C@@H](F)[C@@H](F)C3)nc2Cc2ccccc2)CN2CCC1CC2 |
| InChI | InChI=1S/C25H27F2N3O/c26-21-15-30(16-22(21)27)24-7-6-19(23(28-24)14-18-4-2-1-3-5-18)8-11-25(31)17-29-12-9-20(25)10-13-29/h1-7,20-22,31H,9-10,12-17H2/t21-,22+,25-/m1/s1 |
| InChIKey | ADLKNWQPALYMEY-OTNCWRBYSA-N |
| XLogP | 2.98 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|