About 2-(1H-1,4-diazepin-2-yl)propanamide
2-(1H-1,4-diazepin-2-yl)propanamide (PubChem CID 70003602) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-(1H-1,4-diazepin-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-(1H-1,4-diazepin-2-yl)propanamide |
| PubChem CID | 70003602 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-(1H-1,4-diazepin-2-yl)propanamide |
| SMILES | CC(C(N)=O)C1=CN=CC=CN1 |
| InChI | InChI=1S/C8H11N3O/c1-6(8(9)12)7-5-10-3-2-4-11-7/h2-6,11H,1H3,(H2,9,12) |
| InChIKey | PFKAFAMKKJMUPM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-1,4-diazepin-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-1,4-diazepin-2-yl)propanamide?
The IUPAC name of 2-(1H-1,4-diazepin-2-yl)propanamide (CID 70003602) is 2-(1H-1,4-diazepin-2-yl)propanamide.
What is the SMILES notation for 2-(1H-1,4-diazepin-2-yl)propanamide?
The canonical SMILES for 2-(1H-1,4-diazepin-2-yl)propanamide is CC(C(N)=O)C1=CN=CC=CN1.
What is the InChIKey of 2-(1H-1,4-diazepin-2-yl)propanamide?
The InChIKey is PFKAFAMKKJMUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-6(8(9)12)7-5-10-3-2-4-11-7/h2-6,11H,1H3,(H2,9,12).
What are the key properties of 2-(1H-1,4-diazepin-2-yl)propanamide?
2-(1H-1,4-diazepin-2-yl)propanamide has a molecular weight of 165.20 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,4-diazepin-2-yl)propanamide is sourced from PubChem (CID 70003602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).