C11H16N2O — CID 70003975
2-(2,3,4,8-tetrahydropyrido[3,4-b]azepin-1-yl)ethanol (PubChem CID 70003975) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(2,3,4,8-tetrahydropyrido[3,4-b]azepin-1-yl)ethanol.
| Compound Name | 2-(2,3,4,8-tetrahydropyrido[3,4-b]azepin-1-yl)ethanol |
|---|---|
| PubChem CID | 70003975 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-(2,3,4,8-tetrahydropyrido[3,4-b]azepin-1-yl)ethanol |
| SMILES | OCCN1CCCC=C2C=CNC=C21 |
| InChI | InChI=1S/C11H16N2O/c14-8-7-13-6-2-1-3-10-4-5-12-9-11(10)13/h3-5,9,12,14H,1-2,6-8H2 |
| InChIKey | OUGSFBNRKNYKTG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |