C17H19NO5 — CID 7000417
butyl (3S,3aS,8bR)-3a,8b-dihydroxy-2-methyl-4-oxo-3H-indeno[1,2-b]pyrrole-3-carboxylate (PubChem CID 7000417) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is butyl (3S,3aS,8bR)-3a,8b-dihydroxy-2-methyl-4-oxo-3H-indeno[1,2-b]pyrrole-3-carboxylate.
| Compound Name | butyl (3S,3aS,8bR)-3a,8b-dihydroxy-2-methyl-4-oxo-3H-indeno[1,2-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7000417 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | butyl (3S,3aS,8bR)-3a,8b-dihydroxy-2-methyl-4-oxo-3H-indeno[1,2-b]pyrrole-3-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C(C)=N[C@@]2(O)c3ccccc3C(=O)[C@]12O |
| InChI | InChI=1S/C17H19NO5/c1-3-4-9-23-15(20)13-10(2)18-17(22)12-8-6-5-7-11(12)14(19)16(13,17)21/h5-8,13,21-22H,3-4,9H2,1-2H3/t13-,16-,17-/m1/s1 |
| InChIKey | YEHLRJRSMNPEDT-KBRIMQKVSA-N |
| XLogP | 1.19 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|