C37H39F3N2O2S — CID 70004429
(2S,4R)-N-pentyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide (PubChem CID 70004429) has the molecular formula C37H39F3N2O2S and a molecular weight of 632.79 g/mol. Its IUPAC name is (2S,4R)-N-pentyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide.
| Compound Name | (2S,4R)-N-pentyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 70004429 |
| Molecular Formula | C37H39F3N2O2S |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | (2S,4R)-N-pentyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide |
| SMILES | CCCCCNC(=O)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C37H39F3N2O2S/c1-2-3-13-20-41-36(43)42-24-32(22-31(42)26-44-25-27-21-34(39)35(40)23-33(27)38)45-37(28-14-7-4-8-15-28,29-16-9-5-10-17-29)30-18-11-6-12-19-30/h4-12,14-19,21,23,31-32H,2-3,13,20,22,24-26H2,1H3,(H,41,43)/t31-,32+/m0/s1 |
| InChIKey | ZGFFPENFSQVFOW-AJQTZOPKSA-N |
| XLogP | 8.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|