C26H18Cl2F3N3O7S — CID 70004518
2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70004518) has the molecular formula C26H18Cl2F3N3O7S and a molecular weight of 644.41 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70004518 |
| Molecular Formula | C26H18Cl2F3N3O7S |
| Molecular Weight | 644.41 g/mol |
| Exact Mass | 643.02 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(Oc3cc(NS(=O)(=O)c4ccc(Cl)c(Cl)c4)ccc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C24H17Cl2N3O5S.C2HF3O2/c25-20-8-6-18(12-21(20)26)35(32,33)29-16-4-7-19(24(30)31)22(11-16)34-17-5-3-13-9-15(23(27)28)2-1-14(13)10-17;3-2(4,5)1(6)7/h1-12,29H,(H3,27,28)(H,30,31);(H,6,7) |
| InChIKey | JLOGDWIZKDRHBN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.41 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|