C14H20N2 — CID 70004822
(10aR)-4,6,10-trimethyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 70004822) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (10aR)-4,6,10-trimethyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | (10aR)-4,6,10-trimethyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 70004822 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (10aR)-4,6,10-trimethyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | Cc1cccc2c1N1C(C)CNC[C@H]1C2C |
| InChI | InChI=1S/C14H20N2/c1-9-5-4-6-12-11(3)13-8-15-7-10(2)16(13)14(9)12/h4-6,10-11,13,15H,7-8H2,1-3H3/t10?,11?,13-/m0/s1 |
| InChIKey | KSJQKGRWIINCEO-XIVSLSHWSA-N |
| XLogP | 2.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |