C20H19F3N2O2 — CID 70004870
2-[[1-[4-(4-cyanophenyl)phenyl]-2,2,2-trifluoroethyl]amino]pentanoic acid (PubChem CID 70004870) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-[[1-[4-(4-cyanophenyl)phenyl]-2,2,2-trifluoroethyl]amino]pentanoic acid.
| Compound Name | 2-[[1-[4-(4-cyanophenyl)phenyl]-2,2,2-trifluoroethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70004870 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[[1-[4-(4-cyanophenyl)phenyl]-2,2,2-trifluoroethyl]amino]pentanoic acid |
| SMILES | CCCC(NC(c1ccc(-c2ccc(C#N)cc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H19F3N2O2/c1-2-3-17(19(26)27)25-18(20(21,22)23)16-10-8-15(9-11-16)14-6-4-13(12-24)5-7-14/h4-11,17-18,25H,2-3H2,1H3,(H,26,27) |
| InChIKey | YPMUZPYHEHWCMI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |