C18H21Cl2N5O4 — CID 70004958
3-(3,5-dichlorophenyl)-5-[2-[4-(1H-imidazol-2-ylamino)butanoyl]hydrazinyl]-5-oxopentanoic acid (PubChem CID 70004958) has the molecular formula C18H21Cl2N5O4 and a molecular weight of 442.30 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-5-[2-[4-(1H-imidazol-2-ylamino)butanoyl]hydrazinyl]-5-oxopentanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-5-[2-[4-(1H-imidazol-2-ylamino)butanoyl]hydrazinyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70004958 |
| Molecular Formula | C18H21Cl2N5O4 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-5-[2-[4-(1H-imidazol-2-ylamino)butanoyl]hydrazinyl]-5-oxopentanoic acid |
| SMILES | O=C(O)CC(CC(=O)NNC(=O)CCCNc1ncc[nH]1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H21Cl2N5O4/c19-13-6-11(7-14(20)10-13)12(9-17(28)29)8-16(27)25-24-15(26)2-1-3-21-18-22-4-5-23-18/h4-7,10,12H,1-3,8-9H2,(H,24,26)(H,25,27)(H,28,29)(H2,21,22,23) |
| InChIKey | CZQUGUJYULAMKF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|