C26H19F3N4O9S — CID 70004999
2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3-nitrophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70004999) has the molecular formula C26H19F3N4O9S and a molecular weight of 620.52 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3-nitrophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3-nitrophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70004999 |
| Molecular Formula | C26H19F3N4O9S |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3-nitrophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(Oc3ccc(NS(=O)(=O)c4cccc([N+](=O)[O-])c4)cc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C24H18N4O7S.C2HF3O2/c25-23(26)16-5-4-15-11-19(8-6-14(15)10-16)35-22-9-7-17(12-21(22)24(29)30)27-36(33,34)20-3-1-2-18(13-20)28(31)32;3-2(4,5)1(6)7/h1-13,27H,(H3,25,26)(H,29,30);(H,6,7) |
| InChIKey | ANGSZHSGJNUXNU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 223.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|