C30H22F3N3O7S — CID 70005038
2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70005038) has the molecular formula C30H22F3N3O7S and a molecular weight of 625.58 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70005038 |
| Molecular Formula | C30H22F3N3O7S |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(Oc3ccc(NS(=O)(=O)c4ccc5ccccc5c4)cc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C28H21N3O5S.C2HF3O2/c29-27(30)21-6-5-20-14-23(10-7-19(20)13-21)36-26-12-9-22(16-25(26)28(32)33)31-37(34,35)24-11-8-17-3-1-2-4-18(17)15-24;3-2(4,5)1(6)7/h1-16,31H,(H3,29,30)(H,32,33);(H,6,7) |
| InChIKey | RRCPQHDRNMNYNM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|