C32H24F3N3O7S — CID 70005041
2-[4-(4-carbamimidoylphenyl)phenoxy]-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70005041) has the molecular formula C32H24F3N3O7S and a molecular weight of 651.62 g/mol. Its IUPAC name is 2-[4-(4-carbamimidoylphenyl)phenoxy]-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(4-carbamimidoylphenyl)phenoxy]-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70005041 |
| Molecular Formula | C32H24F3N3O7S |
| Molecular Weight | 651.62 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | 2-[4-(4-carbamimidoylphenyl)phenoxy]-5-(naphthalen-2-ylsulfonylamino)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(-c2ccc(Oc3ccc(NS(=O)(=O)c4ccc5ccccc5c4)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H23N3O5S.C2HF3O2/c31-29(32)22-7-5-20(6-8-22)21-9-13-25(14-10-21)38-28-16-12-24(18-27(28)30(34)35)33-39(36,37)26-15-11-19-3-1-2-4-23(19)17-26;3-2(4,5)1(6)7/h1-18,33H,(H3,31,32)(H,34,35);(H,6,7) |
| InChIKey | MLXAYJIZXGUWTQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|