C9H18O4 — CID 70005079
(2R,3R,4S,6S)-4,6-dimethoxy-2,4-dimethyloxan-3-ol (PubChem CID 70005079) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2R,3R,4S,6S)-4,6-dimethoxy-2,4-dimethyloxan-3-ol.
| Compound Name | (2R,3R,4S,6S)-4,6-dimethoxy-2,4-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 70005079 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2R,3R,4S,6S)-4,6-dimethoxy-2,4-dimethyloxan-3-ol |
| SMILES | CO[C@@H]1C[C@](C)(OC)[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C9H18O4/c1-6-8(10)9(2,12-4)5-7(11-3)13-6/h6-8,10H,5H2,1-4H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | ZXFXXCUAVWXSCJ-XAVMHZPKSA-N |
| XLogP | 0.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |