C9H16O5 — CID 70005413
(2R,4S,5R,6S)-4,5,6-trimethoxy-2-methyloxan-3-one (PubChem CID 70005413) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (2R,4S,5R,6S)-4,5,6-trimethoxy-2-methyloxan-3-one.
| Compound Name | (2R,4S,5R,6S)-4,5,6-trimethoxy-2-methyloxan-3-one |
|---|---|
| PubChem CID | 70005413 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2R,4S,5R,6S)-4,5,6-trimethoxy-2-methyloxan-3-one |
| SMILES | CO[C@H]1O[C@H](C)C(=O)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C9H16O5/c1-5-6(10)7(11-2)8(12-3)9(13-4)14-5/h5,7-9H,1-4H3/t5-,7-,8-,9+/m1/s1 |
| InChIKey | IIUVUGQROLILHX-YYNOVJQHSA-N |
| XLogP | -0.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |