C31H28ClNO2 — CID 70005826
1-[2-[4-[[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]methyl]phenoxy]ethyl]-2H-pyridine (PubChem CID 70005826) has the molecular formula C31H28ClNO2 and a molecular weight of 482.02 g/mol. Its IUPAC name is 1-[2-[4-[[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]methyl]phenoxy]ethyl]-2H-pyridine.
| Compound Name | 1-[2-[4-[[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]methyl]phenoxy]ethyl]-2H-pyridine |
|---|---|
| PubChem CID | 70005826 |
| Molecular Formula | C31H28ClNO2 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-[2-[4-[[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]methyl]phenoxy]ethyl]-2H-pyridine |
| SMILES | COc1ccc2c(Cc3ccc(OCCN4C=CC=CC4)cc3)c(-c3cccc(Cl)c3)ccc2c1 |
| InChI | InChI=1S/C31H28ClNO2/c1-34-28-13-15-30-25(22-28)10-14-29(24-6-5-7-26(32)21-24)31(30)20-23-8-11-27(12-9-23)35-19-18-33-16-3-2-4-17-33/h2-16,21-22H,17-20H2,1H3 |
| InChIKey | JLVVGQRSVMVUJD-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |