C37H51N15O4 — CID 70006042
3-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]benzoic acid;ethyl 4-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]piperidine-1-carboxylate (PubChem CID 70006042) has the molecular formula C37H51N15O4 and a molecular weight of 769.92 g/mol. Its IUPAC name is 3-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]benzoic acid;ethyl 4-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]piperidine-1-carboxylate.
| Compound Name | 3-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]benzoic acid;ethyl 4-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70006042 |
| Molecular Formula | C37H51N15O4 |
| Molecular Weight | 769.92 g/mol |
| Exact Mass | 769.42 |
| IUPAC Name | 3-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]benzoic acid;ethyl 4-[[2-[(4-aminocyclohexyl)amino]-7H-purin-6-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nc(NC3CCC(N)CC3)nc3nc[nH]c23)CC1.NC1CCC(Nc2nc(Nc3cccc(C(=O)O)c3)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C19H30N8O2.C18H21N7O2/c1-2-29-19(28)27-9-7-14(8-10-27)23-17-15-16(22-11-21-15)25-18(26-17)24-13-5-3-12(20)4-6-13;19-11-4-6-12(7-5-11)23-18-24-15-14(20-9-21-15)16(25-18)22-13-3-1-2-10(8-13)17(26)27/h11-14H,2-10,20H2,1H3,(H3,21,22,23,24,25,26);1-3,8-9,11-12H,4-7,19H2,(H,26,27)(H3,20,21,22,23,24,25) |
| InChIKey | BYDJHXCHKSWGPZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 275.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |