C28H30O6 — CID 70006509
(2R,4R,5R,6R)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-one (PubChem CID 70006509) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is (2R,4R,5R,6R)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-one.
| Compound Name | (2R,4R,5R,6R)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 70006509 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (2R,4R,5R,6R)-4,5,6-trimethoxy-2-(trityloxymethyl)oxan-3-one |
| SMILES | CO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C28H30O6/c1-30-25-24(29)23(34-27(32-3)26(25)31-2)19-33-28(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23,25-27H,19H2,1-3H3/t23-,25+,26-,27-/m1/s1 |
| InChIKey | RQVQOMQUZKDZMP-INVSNAKLSA-N |
| XLogP | 3.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|