C7H6N3O5- — CID 7000656
2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]acetate (PubChem CID 7000656) has the molecular formula C7H6N3O5- and a molecular weight of 212.14 g/mol. Its IUPAC name is 2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]acetate.
| Compound Name | 2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]acetate |
|---|---|
| PubChem CID | 7000656 |
| Molecular Formula | C7H6N3O5- |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]acetate |
| SMILES | O=C([O-])C/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C7H7N3O5/c11-4(12)2-8-1-3-5(13)9-7(15)10-6(3)14/h1,3H,2H2,(H,11,12)(H2,9,10,13,14,15)/p-1/b8-1+ |
| InChIKey | SLMSRZPVACESQF-UNXLUWIOSA-M |
| XLogP | -3.21 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|