About methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate
methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate (PubChem CID 70006779) has the molecular formula C27H50O3Sn
and a molecular weight of 541.41 g/mol. Its IUPAC name is methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate |
| PubChem CID | 70006779 |
| Molecular Formula | C27H50O3Sn |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate |
| SMILES | CCCC[Sn](C=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OC)(CCCC)CCCC |
| InChI | InChI=1S/C15H23O3.3C4H9.Sn/c1-3-12-10-11-14(16)13(12)8-6-4-5-7-9-15(17)18-2;3*1-3-4-2;/h1,3,12-13H,4-11H2,2H3;3*1,3-4H2,2H3;/t12-,13+;;;;/m0..../s1 |
| InChIKey | ZRLBBWMQJCPZKQ-FAUPVZFVSA-N |
| XLogP | 8.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate (CID 70006779) is methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate is CCCC[Sn](C=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OC)(CCCC)CCCC.
What is the InChIKey of methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate?
The InChIKey is ZRLBBWMQJCPZKQ-FAUPVZFVSA-N. The full InChI is InChI=1S/C15H23O3.3C4H9.Sn/c1-3-12-10-11-14(16)13(12)8-6-4-5-7-9-15(17)18-2;3*1-3-4-2;/h1,3,12-13H,4-11H2,2H3;3*1,3-4H2,2H3;/t12-,13+;;;;/m0..../s1.
What are the key properties of methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate?
methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate has a molecular weight of 541.41 g/mol, XLogP of 8.04, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1R,5S)-2-oxo-5-(2-tributylstannylethenyl)cyclopentyl]heptanoate is sourced from PubChem (CID 70006779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).