C29H32O2S — CID 70007262
2-ethyl-4-[2-(5,5,8,8-tetramethyl-3-thiophen-3-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 70007262) has the molecular formula C29H32O2S and a molecular weight of 444.64 g/mol. Its IUPAC name is 2-ethyl-4-[2-(5,5,8,8-tetramethyl-3-thiophen-3-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | 2-ethyl-4-[2-(5,5,8,8-tetramethyl-3-thiophen-3-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 70007262 |
| Molecular Formula | C29H32O2S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-ethyl-4-[2-(5,5,8,8-tetramethyl-3-thiophen-3-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | CCc1cc(C=Cc2cc3c(cc2-c2ccsc2)C(C)(C)CCC3(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C29H32O2S/c1-6-20-15-19(8-10-23(20)27(30)31)7-9-21-16-25-26(17-24(21)22-11-14-32-18-22)29(4,5)13-12-28(25,2)3/h7-11,14-18H,6,12-13H2,1-5H3,(H,30,31) |
| InChIKey | NRUXCMRZICQZRR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|