C16H23N3O3 — CID 70007269
6-(2,4-diaminophenyl)-3,4-dimethyl-3-(2-methylpropyl)morpholine-2,5-dione (PubChem CID 70007269) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-(2,4-diaminophenyl)-3,4-dimethyl-3-(2-methylpropyl)morpholine-2,5-dione.
| Compound Name | 6-(2,4-diaminophenyl)-3,4-dimethyl-3-(2-methylpropyl)morpholine-2,5-dione |
|---|---|
| PubChem CID | 70007269 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 6-(2,4-diaminophenyl)-3,4-dimethyl-3-(2-methylpropyl)morpholine-2,5-dione |
| SMILES | CC(C)CC1(C)C(=O)OC(c2ccc(N)cc2N)C(=O)N1C |
| InChI | InChI=1S/C16H23N3O3/c1-9(2)8-16(3)15(21)22-13(14(20)19(16)4)11-6-5-10(17)7-12(11)18/h5-7,9,13H,8,17-18H2,1-4H3 |
| InChIKey | ZMLIKFIHEIPNMB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|