About [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite
[4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite (PubChem CID 70007754) has the molecular formula C8H7F3O3S
and a molecular weight of 240.20 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite.
Molecular Properties
| Compound Name | [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite |
| PubChem CID | 70007754 |
| Molecular Formula | C8H7F3O3S |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite |
| SMILES | O=S(O)Oc1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3O3S/c9-8(10,11)5-6-1-3-7(4-2-6)14-15(12)13/h1-4H,5H2,(H,12,13) |
| InChIKey | RLVOIDJUQJTTCM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite?
The IUPAC name of [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite (CID 70007754) is [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite.
What is the SMILES notation for [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite?
The canonical SMILES for [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite is O=S(O)Oc1ccc(CC(F)(F)F)cc1.
What is the InChIKey of [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite?
The InChIKey is RLVOIDJUQJTTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O3S/c9-8(10,11)5-6-1-3-7(4-2-6)14-15(12)13/h1-4H,5H2,(H,12,13).
What are the key properties of [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite?
[4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite has a molecular weight of 240.20 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2,2-trifluoroethyl)phenyl] hydrogen sulfite is sourced from PubChem (CID 70007754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).