C12H17N3O4 — CID 70008029
1-(2-hydroxypropyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 70008029) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2-hydroxypropyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70008029 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(2-hydroxypropyl)-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(C)O)c1=O |
| InChI | InChI=1S/C12H17N3O4/c1-4-6-13-10(17)14(7-5-2)12(19)15(11(13)18)8-9(3)16/h4-5,9,16H,1-2,6-8H2,3H3 |
| InChIKey | FIXHGBSZPJRJAL-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|