C16H19N3O — CID 70008257
5-cyclohexyl-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one (PubChem CID 70008257) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 5-cyclohexyl-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one.
| Compound Name | 5-cyclohexyl-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 70008257 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-cyclohexyl-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
| SMILES | O=C1C=CC2=CN=C(C3CCCCC3)N3CCC(=C23)N1 |
| InChI | InChI=1S/C16H19N3O/c20-14-7-6-12-10-17-16(11-4-2-1-3-5-11)19-9-8-13(18-14)15(12)19/h6-7,10-11H,1-5,8-9H2,(H,18,20) |
| InChIKey | VCKUVUANXVMNLH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |