C23H20BrNOS — CID 70008328
1-(5-bromo-3-pyridinyl)-2-(4-methylsulfanylphenyl)-5-phenylpent-4-en-1-one (PubChem CID 70008328) has the molecular formula C23H20BrNOS and a molecular weight of 438.39 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-2-(4-methylsulfanylphenyl)-5-phenylpent-4-en-1-one.
| Compound Name | 1-(5-bromo-3-pyridinyl)-2-(4-methylsulfanylphenyl)-5-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 70008328 |
| Molecular Formula | C23H20BrNOS |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-2-(4-methylsulfanylphenyl)-5-phenylpent-4-en-1-one |
| SMILES | CSc1ccc(C(CC=Cc2ccccc2)C(=O)c2cncc(Br)c2)cc1 |
| InChI | InChI=1S/C23H20BrNOS/c1-27-21-12-10-18(11-13-21)22(9-5-8-17-6-3-2-4-7-17)23(26)19-14-20(24)16-25-15-19/h2-8,10-16,22H,9H2,1H3 |
| InChIKey | OKTJIRVZNVWYAW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |