About 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one
5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one (PubChem CID 70008434) has the molecular formula C28H19Br2NO
and a molecular weight of 545.27 g/mol. Its IUPAC name is 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one |
| PubChem CID | 70008434 |
| Molecular Formula | C28H19Br2NO |
| Molecular Weight | 545.27 g/mol |
| Exact Mass | 542.98 |
| IUPAC Name | 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one |
| SMILES | CC1=C(c2ccc3ccccc3c2)c2ccccc2C1C1C(=O)Nc2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C28H19Br2NO/c1-15-24(18-11-10-16-6-2-3-7-17(16)12-18)20-8-4-5-9-21(20)25(15)26-22-13-19(29)14-23(30)27(22)31-28(26)32/h2-14,25-26H,1H3,(H,31,32) |
| InChIKey | JWUWOPZJMKWTSM-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.27 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one?
The IUPAC name of 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one (CID 70008434) is 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one?
The canonical SMILES for 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one is CC1=C(c2ccc3ccccc3c2)c2ccccc2C1C1C(=O)Nc2c(Br)cc(Br)cc21.
What is the InChIKey of 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one?
The InChIKey is JWUWOPZJMKWTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19Br2NO/c1-15-24(18-11-10-16-6-2-3-7-17(16)12-18)20-8-4-5-9-21(20)25(15)26-22-13-19(29)14-23(30)27(22)31-28(26)32/h2-14,25-26H,1H3,(H,31,32).
What are the key properties of 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one?
5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one has a molecular weight of 545.27 g/mol, XLogP of 8.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromo-3-(2-methyl-3-naphthalen-2-yl-1H-inden-1-yl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 70008434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).