C23H20ClF3N2O4 — CID 70009418
(2R)-N-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide (PubChem CID 70009418) has the molecular formula C23H20ClF3N2O4 and a molecular weight of 480.87 g/mol. Its IUPAC name is (2R)-N-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide.
| Compound Name | (2R)-N-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide |
|---|---|
| PubChem CID | 70009418 |
| Molecular Formula | C23H20ClF3N2O4 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (2R)-N-[(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide |
| SMILES | Cc1noc(=O)c2ccc(N(CC3CCCc4cc(Cl)ccc43)C(=O)[C@@H](O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C23H20ClF3N2O4/c1-12-19-10-16(6-8-18(19)22(32)33-28-12)29(21(31)20(30)23(25,26)27)11-14-4-2-3-13-9-15(24)5-7-17(13)14/h5-10,14,20,30H,2-4,11H2,1H3/t14?,20-/m1/s1 |
| InChIKey | WECIIEFTUGFKJF-YBMSBYLISA-N |
| XLogP | 4.53 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |