About 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one
5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one (PubChem CID 70010057) has the molecular formula C29H22BrNO
and a molecular weight of 480.41 g/mol. Its IUPAC name is 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one |
| PubChem CID | 70010057 |
| Molecular Formula | C29H22BrNO |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one |
| SMILES | Cc1c(Br)ccc2c1C(C1C(Cc3ccc4ccccc4c3)=Cc3ccccc31)C(=O)N2 |
| InChI | InChI=1S/C29H22BrNO/c1-17-24(30)12-13-25-26(17)28(29(32)31-25)27-22(16-21-8-4-5-9-23(21)27)15-18-10-11-19-6-2-3-7-20(19)14-18/h2-14,16,27-28H,15H2,1H3,(H,31,32) |
| InChIKey | GZKRHKYFUCVOJU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one?
The IUPAC name of 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one (CID 70010057) is 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one?
The canonical SMILES for 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one is Cc1c(Br)ccc2c1C(C1C(Cc3ccc4ccccc4c3)=Cc3ccccc31)C(=O)N2.
What is the InChIKey of 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one?
The InChIKey is GZKRHKYFUCVOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22BrNO/c1-17-24(30)12-13-25-26(17)28(29(32)31-25)27-22(16-21-8-4-5-9-23(21)27)15-18-10-11-19-6-2-3-7-20(19)14-18/h2-14,16,27-28H,15H2,1H3,(H,31,32).
What are the key properties of 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one?
5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one has a molecular weight of 480.41 g/mol, XLogP of 7.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methyl-3-[2-(naphthalen-2-ylmethyl)-1H-inden-1-yl]-1,3-dihydroindol-2-one is sourced from PubChem (CID 70010057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).