About 2-methyl-5,6-dipropyl-1H-pyridazine
2-methyl-5,6-dipropyl-1H-pyridazine (PubChem CID 70010314) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-methyl-5,6-dipropyl-1H-pyridazine.
Molecular Properties
| Compound Name | 2-methyl-5,6-dipropyl-1H-pyridazine |
| PubChem CID | 70010314 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-methyl-5,6-dipropyl-1H-pyridazine |
| SMILES | CCCC1=C(CCC)NN(C)C=C1 |
| InChI | InChI=1S/C11H20N2/c1-4-6-10-8-9-13(3)12-11(10)7-5-2/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | BZGBOMPSCOQXAL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5,6-dipropyl-1H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6-dipropyl-1H-pyridazine?
The IUPAC name of 2-methyl-5,6-dipropyl-1H-pyridazine (CID 70010314) is 2-methyl-5,6-dipropyl-1H-pyridazine.
What is the SMILES notation for 2-methyl-5,6-dipropyl-1H-pyridazine?
The canonical SMILES for 2-methyl-5,6-dipropyl-1H-pyridazine is CCCC1=C(CCC)NN(C)C=C1.
What is the InChIKey of 2-methyl-5,6-dipropyl-1H-pyridazine?
The InChIKey is BZGBOMPSCOQXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-6-10-8-9-13(3)12-11(10)7-5-2/h8-9,12H,4-7H2,1-3H3.
What are the key properties of 2-methyl-5,6-dipropyl-1H-pyridazine?
2-methyl-5,6-dipropyl-1H-pyridazine has a molecular weight of 180.29 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-dipropyl-1H-pyridazine is sourced from PubChem (CID 70010314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).