About 1-methyl-5,6-dipropyl-2H-pyrazine
1-methyl-5,6-dipropyl-2H-pyrazine (PubChem CID 70010315) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-methyl-5,6-dipropyl-2H-pyrazine.
Molecular Properties
| Compound Name | 1-methyl-5,6-dipropyl-2H-pyrazine |
| PubChem CID | 70010315 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-methyl-5,6-dipropyl-2H-pyrazine |
| SMILES | CCCC1=C(CCC)N(C)CC=N1 |
| InChI | InChI=1S/C11H20N2/c1-4-6-10-11(7-5-2)13(3)9-8-12-10/h8H,4-7,9H2,1-3H3 |
| InChIKey | JTRMXXAANPAIOJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-5,6-dipropyl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-dipropyl-2H-pyrazine?
The IUPAC name of 1-methyl-5,6-dipropyl-2H-pyrazine (CID 70010315) is 1-methyl-5,6-dipropyl-2H-pyrazine.
What is the SMILES notation for 1-methyl-5,6-dipropyl-2H-pyrazine?
The canonical SMILES for 1-methyl-5,6-dipropyl-2H-pyrazine is CCCC1=C(CCC)N(C)CC=N1.
What is the InChIKey of 1-methyl-5,6-dipropyl-2H-pyrazine?
The InChIKey is JTRMXXAANPAIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-6-10-11(7-5-2)13(3)9-8-12-10/h8H,4-7,9H2,1-3H3.
What are the key properties of 1-methyl-5,6-dipropyl-2H-pyrazine?
1-methyl-5,6-dipropyl-2H-pyrazine has a molecular weight of 180.30 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-dipropyl-2H-pyrazine is sourced from PubChem (CID 70010315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).