C10H21ClOSi — CID 70010408
2-chloro-2,4,5,5,6,6-hexamethyloxasilinane (PubChem CID 70010408) has the molecular formula C10H21ClOSi and a molecular weight of 220.82 g/mol. Its IUPAC name is 2-chloro-2,4,5,5,6,6-hexamethyloxasilinane.
| Compound Name | 2-chloro-2,4,5,5,6,6-hexamethyloxasilinane |
|---|---|
| PubChem CID | 70010408 |
| Molecular Formula | C10H21ClOSi |
| Molecular Weight | 220.82 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-chloro-2,4,5,5,6,6-hexamethyloxasilinane |
| SMILES | CC1C[Si](C)(Cl)OC(C)(C)C1(C)C |
| InChI | InChI=1S/C10H21ClOSi/c1-8-7-13(6,11)12-10(4,5)9(8,2)3/h8H,7H2,1-6H3 |
| InChIKey | ZKKKRGNBIIPPEC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|