About 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile
2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile (PubChem CID 70010516) has the molecular formula C22H19N3O3S
and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile |
| PubChem CID | 70010516 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile |
| SMILES | N#Cc1cc2ccccc2nc1-c1ccco1.NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H8N2O.C8H11NO2S/c15-9-11-8-10-4-1-2-5-12(10)16-14(11)13-6-3-7-17-13;9-6-7-12(10,11)8-4-2-1-3-5-8/h1-8H;1-5H,6-7,9H2 |
| InChIKey | FJRSGXRWHNSLFE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile?
The IUPAC name of 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile (CID 70010516) is 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile.
What is the SMILES notation for 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile?
The canonical SMILES for 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile is N#Cc1cc2ccccc2nc1-c1ccco1.NCCS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile?
The InChIKey is FJRSGXRWHNSLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O.C8H11NO2S/c15-9-11-8-10-4-1-2-5-12(10)16-14(11)13-6-3-7-17-13;9-6-7-12(10,11)8-4-2-1-3-5-8/h1-8H;1-5H,6-7,9H2.
What are the key properties of 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile?
2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile has a molecular weight of 405.48 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)ethanamine;2-(furan-2-yl)quinoline-3-carbonitrile is sourced from PubChem (CID 70010516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).