bicyclo[2.2.1]hept-1-ene;molecular nitrogen

C7H10N2 — CID 70010786

IUPACbicyclo[2.2.1]hept-1-ene;molecular nitrogen
SMILESC1=C2CCC(C1)C2.N#N
InChIInChI=1S/C7H10.N2/c1-2-7-4-3-6(1)5-7;1-2/h1,7H,2-5H2;
InChIKeyNYPHMAKSEXMRFU-UHFFFAOYSA-N
MW122.17 g/mol
LogP2.15
Rot. Bonds

About bicyclo[2.2.1]hept-1-ene;molecular nitrogen

bicyclo[2.2.1]hept-1-ene;molecular nitrogen (PubChem CID 70010786) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;molecular nitrogen.

Molecular Properties

Compound Namebicyclo[2.2.1]hept-1-ene;molecular nitrogen
PubChem CID70010786
Molecular FormulaC7H10N2
Molecular Weight122.17 g/mol
Exact Mass122.08
IUPAC Namebicyclo[2.2.1]hept-1-ene;molecular nitrogen
SMILESC1=C2CCC(C1)C2.N#N
InChIInChI=1S/C7H10.N2/c1-2-7-4-3-6(1)5-7;1-2/h1,7H,2-5H2;
InChIKeyNYPHMAKSEXMRFU-UHFFFAOYSA-N
XLogP2.15
TPSA47.58 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500122.17
LogP ≤ 52.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze bicyclo[2.2.1]hept-1-ene;molecular nitrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;molecular nitrogen?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;molecular nitrogen (CID 70010786) is bicyclo[2.2.1]hept-1-ene;molecular nitrogen.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;molecular nitrogen?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;molecular nitrogen is C1=C2CCC(C1)C2.N#N.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;molecular nitrogen?
The InChIKey is NYPHMAKSEXMRFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.N2/c1-2-7-4-3-6(1)5-7;1-2/h1,7H,2-5H2;.
What are the key properties of bicyclo[2.2.1]hept-1-ene;molecular nitrogen?
bicyclo[2.2.1]hept-1-ene;molecular nitrogen has a molecular weight of 122.17 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;molecular nitrogen is sourced from PubChem (CID 70010786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).