C22H24N2O5 — CID 70011102
2-[3-(2-amino-1,2-dihydroxyethyl)-1-benzyl-2-cyclopropylindol-4-yl]oxyacetic acid (PubChem CID 70011102) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[3-(2-amino-1,2-dihydroxyethyl)-1-benzyl-2-cyclopropylindol-4-yl]oxyacetic acid.
| Compound Name | 2-[3-(2-amino-1,2-dihydroxyethyl)-1-benzyl-2-cyclopropylindol-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 70011102 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[3-(2-amino-1,2-dihydroxyethyl)-1-benzyl-2-cyclopropylindol-4-yl]oxyacetic acid |
| SMILES | NC(O)C(O)c1c(C2CC2)n(Cc2ccccc2)c2cccc(OCC(=O)O)c12 |
| InChI | InChI=1S/C22H24N2O5/c23-22(28)21(27)19-18-15(7-4-8-16(18)29-12-17(25)26)24(20(19)14-9-10-14)11-13-5-2-1-3-6-13/h1-8,14,21-22,27-28H,9-12,23H2,(H,25,26) |
| InChIKey | PTNIOAOHEXDBAY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|