C10H12N4O3 — CID 70011183
(2R,3S,4R)-2-methyl-5-(7H-purin-8-yl)oxolane-3,4-diol (PubChem CID 70011183) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is (2R,3S,4R)-2-methyl-5-(7H-purin-8-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-methyl-5-(7H-purin-8-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70011183 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2R,3S,4R)-2-methyl-5-(7H-purin-8-yl)oxolane-3,4-diol |
| SMILES | C[C@H]1OC(c2nc3ncncc3[nH]2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H12N4O3/c1-4-6(15)7(16)8(17-4)10-13-5-2-11-3-12-9(5)14-10/h2-4,6-8,15-16H,1H3,(H,11,12,13,14)/t4-,6-,7-,8?/m1/s1 |
| InChIKey | RJXIHZSLQKVRSS-ZRTZXPPTSA-N |
| XLogP | -0.47 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |