C30H30N4 — CID 70011379
1,5,10-trimethyl-7-(5,6,10-trimethylphenazin-2-yl)phenazine (PubChem CID 70011379) has the molecular formula C30H30N4 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1,5,10-trimethyl-7-(5,6,10-trimethylphenazin-2-yl)phenazine.
| Compound Name | 1,5,10-trimethyl-7-(5,6,10-trimethylphenazin-2-yl)phenazine |
|---|---|
| PubChem CID | 70011379 |
| Molecular Formula | C30H30N4 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1,5,10-trimethyl-7-(5,6,10-trimethylphenazin-2-yl)phenazine |
| SMILES | Cc1cccc2c1N(C)c1ccc(-c3ccc4c(c3)N(C)c3cccc(C)c3N4C)cc1N2C |
| InChI | InChI=1S/C30H30N4/c1-19-9-7-11-25-29(19)33(5)23-15-13-21(17-27(23)31(25)3)22-14-16-24-28(18-22)32(4)26-12-8-10-20(2)30(26)34(24)6/h7-18H,1-6H3 |
| InChIKey | BJFUTWZJKYMFEA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |