About [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate
[4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate (PubChem CID 700115) has the molecular formula C13H13N3O4
and a molecular weight of 275.26 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate |
| PubChem CID | 700115 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate |
| SMILES | O=C(Oc1ccc(-c2nnco2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C13H13N3O4/c17-13(16-5-7-18-8-6-16)20-11-3-1-10(2-4-11)12-15-14-9-19-12/h1-4,9H,5-8H2 |
| InChIKey | NLOHTQAYXWBHKO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate?
The IUPAC name of [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate (CID 700115) is [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate.
What is the SMILES notation for [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate?
The canonical SMILES for [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate is O=C(Oc1ccc(-c2nnco2)cc1)N1CCOCC1.
What is the InChIKey of [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate?
The InChIKey is NLOHTQAYXWBHKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4/c17-13(16-5-7-18-8-6-16)20-11-3-1-10(2-4-11)12-15-14-9-19-12/h1-4,9H,5-8H2.
What are the key properties of [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate?
[4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate has a molecular weight of 275.26 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3,4-oxadiazol-2-yl)phenyl] morpholine-4-carboxylate is sourced from PubChem (CID 700115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).