C15H17Cl3CoN5 — CID 70011500
2,6-bis(1-ethylimidazol-2-yl)pyridine;cobalt(3+);trichloride (PubChem CID 70011500) has the molecular formula C15H17Cl3CoN5 and a molecular weight of 432.63 g/mol. Its IUPAC name is 2,6-bis(1-ethylimidazol-2-yl)pyridine;cobalt(3+);trichloride.
| Compound Name | 2,6-bis(1-ethylimidazol-2-yl)pyridine;cobalt(3+);trichloride |
|---|---|
| PubChem CID | 70011500 |
| Molecular Formula | C15H17Cl3CoN5 |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 2,6-bis(1-ethylimidazol-2-yl)pyridine;cobalt(3+);trichloride |
| SMILES | CCn1ccnc1-c1cccc(-c2nccn2CC)n1.[Cl-].[Cl-].[Cl-].[Co+3] |
| InChI | InChI=1S/C15H17N5.3ClH.Co/c1-3-19-10-8-16-14(19)12-6-5-7-13(18-12)15-17-9-11-20(15)4-2;;;;/h5-11H,3-4H2,1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | RXRZGTJRVXMSLH-UHFFFAOYSA-K |
| XLogP | -6.14 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |