About 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol
2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol (PubChem CID 70011805) has the molecular formula C24H21N3OS
and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol.
Molecular Properties
| Compound Name | 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol |
| PubChem CID | 70011805 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(CC=C)c(O)c(-n2nc3ccc(Sc4ccccc4)cc3n2)c1 |
| InChI | InChI=1S/C24H21N3OS/c1-3-8-17-14-18(9-4-2)24(28)23(15-17)27-25-21-13-12-20(16-22(21)26-27)29-19-10-6-5-7-11-19/h3-7,10-16,28H,1-2,8-9H2 |
| InChIKey | BGJHWLREJZWLPW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol?
The IUPAC name of 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol (CID 70011805) is 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol.
What is the SMILES notation for 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol?
The canonical SMILES for 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol is C=CCc1cc(CC=C)c(O)c(-n2nc3ccc(Sc4ccccc4)cc3n2)c1.
What is the InChIKey of 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol?
The InChIKey is BGJHWLREJZWLPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3OS/c1-3-8-17-14-18(9-4-2)24(28)23(15-17)27-25-21-13-12-20(16-22(21)26-27)29-19-10-6-5-7-11-19/h3-7,10-16,28H,1-2,8-9H2.
What are the key properties of 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol?
2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol has a molecular weight of 399.52 g/mol, XLogP of 5.73, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-phenylsulfanylbenzotriazol-2-yl)-4,6-bis(prop-2-enyl)phenol is sourced from PubChem (CID 70011805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).