C23H27F3N6O8 — CID 70012234
3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyrimidin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70012234) has the molecular formula C23H27F3N6O8 and a molecular weight of 572.50 g/mol. Its IUPAC name is 3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyrimidin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyrimidin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70012234 |
| Molecular Formula | C23H27F3N6O8 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyrimidin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(CC(=O)O)NC(=O)CNC(=O)CCCCNc2ncccn2)cc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N6O6.C2HF3O2/c1-14-6-7-15(11-17(14)27(32)33)16(12-20(30)31)26-19(29)13-25-18(28)5-2-3-8-22-21-23-9-4-10-24-21;3-2(4,5)1(6)7/h4,6-7,9-11,16H,2-3,5,8,12-13H2,1H3,(H,25,28)(H,26,29)(H,30,31)(H,22,23,24);(H,6,7) |
| InChIKey | JFQQUJNDKFLPPD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 213.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|